Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D185208-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$152.90
|
|
| Synonyms | 558465-93-3 | (2,5-dichloropyridin-3-yl)methanol | 2,5-Dichloropyridine-3-methanol | 2,5-DICHLORO-3-HYDROXYMETHYLPYRIDINE | (2,5-dichloro-3-pyridinyl)methanol | 2,5-Dichloro-3-(hydroxymethyl)pyridine | MFCD06659487 | SCHEMBL10325290 | DTXSID40594711 | OMVBAPGBNPDUNI-UHFFFA |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Polyhalopyridines |
| Alternative Parents | 2-halopyridines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Primary alcohols Organonitrogen compounds Organochlorides Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - 2-halopyridine - Aryl chloride - Aryl halide - Heteroaromatic compound - Azacycle - Alcohol - Hydrocarbon derivative - Aromatic alcohol - Primary alcohol - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polyhalopyridines. These are organic compounds containing a pyridine ring substituted at two or more positions by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2,5-dichloropyridin-3-yl)methanol |
|---|---|
| INCHI | InChI=1S/C6H5Cl2NO/c7-5-1-4(3-10)6(8)9-2-5/h1-2,10H,3H2 |
| InChIKey | OMVBAPGBNPDUNI-UHFFFAOYSA-N |
| Smiles | C1=C(C=NC(=C1CO)Cl)Cl |
| Isomeric SMILES | C1=C(C=NC(=C1CO)Cl)Cl |
| Molecular Weight | 178 |
| Reaxy-Rn | 14303294 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14303294&ln= |
| Molecular Weight | 178.010 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 176.975 Da |
| Monoisotopic Mass | 176.975 Da |
| Topological Polar Surface Area | 33.100 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 112.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |