Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B432536-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$771.90
|
|
| Synonyms | 2,5-Bis(bromomethyl)-1-methoxy-4-(3',7'-dimethyloctyloxy)benzene, 96% | DTXSID80399883 | 2 5-BIS(BROMOMETHYL)-1-METHOXY-4-(3'-7'& | 2 5-BIS(BROMOMETHYL)-1-METHOXY-4-(3-7& | 1,4-bis(bromomethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene | 2,5-Bis(bromomethyl |
|---|---|
| Specifications & Purity | ≥96% |
| Product Description |
Application Conducting polymer precursor for synthesis of substituted PPV. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzyl halides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzyl bromides |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Anisoles Alkyl aryl ethers Organobromides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Methoxybenzene - Benzyl bromide - Phenol ether - Anisole - Alkyl aryl ether - Ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organobromide - Organohalogen compound - Alkyl halide - Alkyl bromide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzyl bromides. These are organic compounds containing a benzene skeleton substituted with a bromomethyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,4-bis(bromomethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene |
|---|---|
| INCHI | InChI=1S/C19H30Br2O2/c1-14(2)6-5-7-15(3)8-9-23-19-11-16(12-20)18(22-4)10-17(19)13-21/h10-11,14-15H,5-9,12-13H2,1-4H3 |
| InChIKey | DOKSAXJBKYCNRE-UHFFFAOYSA-N |
| Smiles | CC(C)CCCC(C)CCOC1=CC(=C(C=C1CBr)OC)CBr |
| Isomeric SMILES | CC(C)CCCC(C)CCOC1=CC(=C(C=C1CBr)OC)CBr |
| Reaxy-Rn | 48171350 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=48171350&ln= |
| Molecular Weight | 450.200 g/mol |
|---|---|
| XLogP3 | 7.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 11 |
| Exact Mass | 450.059 Da |
| Monoisotopic Mass | 448.061 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 299.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |