Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T630692-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$96.90
|
|
|
T630692-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$290.90
|
|
|
T630692-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$484.90
|
|
| Synonyms | 2,5,6-Trichloro-3-methylpyrimidin-4(3H)-one | 1821308-45-5 | 2,5,6-trichloro-3-methyl-3,4-dihydropyrimidin-4-one | 2,5,6-trichloro-3-methylpyrimidin-4-one | SCHEMBL17222716 | EX-A2843 | MFCD30470569 | AKOS037648799 | SB60539 | BS-15649 | CS-0161518 | P199 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| IUPAC Name | 2,5,6-trichloro-3-methylpyrimidin-4-one |
|---|---|
| INCHI | InChI=1S/C5H3Cl3N2O/c1-10-4(11)2(6)3(7)9-5(10)8/h1H3 |
| InChIKey | QYISNYYGONBDTR-UHFFFAOYSA-N |
| Smiles | CN1C(=O)C(=C(N=C1Cl)Cl)Cl |
| Isomeric SMILES | CN1C(=O)C(=C(N=C1Cl)Cl)Cl |
| PubChem CID | 118483215 |
| Molecular Weight | 213.44 |
| Molecular Weight | 213.440 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 211.931 Da |
| Monoisotopic Mass | 211.931 Da |
| Topological Polar Surface Area | 32.700 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 271.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |