Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P168411-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$715.90
|
|
Discover 2-(4-Pyridinyl)-6-(trifluoromethyl)-4-pyrimidinol by Aladdin Scientific in for only $715.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(4-Pyridinyl)-6-(trifluoromethyl)-4-pyrimidinol | 204394-60-5 | 2-(Pyridin-4-yl)-6-(trifluoromethyl)pyrimidin-4(3H)-one | 2-pyridin-4-yl-4-(trifluoromethyl)-1H-pyrimidin-6-one | 2-(pyridin-4-yl)-6-(trifluoromethyl)pyrimidin-4-ol | XMNMTBUCSOFHDQ-UHFFFAOYSA-N | DTXS |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridinylpyrimidines |
| Alternative Parents | Pyrimidones Pyridines and derivatives Hydropyrimidines Vinylogous amides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridinylpyrimidine - Pyrimidone - Hydropyrimidine - Pyridine - Vinylogous amide - Heteroaromatic compound - Azacycle - Alkyl fluoride - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic nitrogen compound - Alkyl halide - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridinylpyrimidines. These are compounds containing a pyridinylpyrimidine skeleton, which consists of a pyridine linked (not fused) to a pyrimidine by a bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-pyridin-4-yl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| INCHI | InChI=1S/C10H6F3N3O/c11-10(12,13)7-5-8(17)16-9(15-7)6-1-3-14-4-2-6/h1-5H,(H,15,16,17) |
| InChIKey | XMNMTBUCSOFHDQ-UHFFFAOYSA-N |
| Smiles | C1=CN=CC=C1C2=NC(=CC(=O)N2)C(F)(F)F |
| Isomeric SMILES | C1=CN=CC=C1C2=NC(=CC(=O)N2)C(F)(F)F |
| PubChem CID | 135410010 |
| Molecular Weight | 241.17 |
| Molecular Weight | 241.170 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 241.046 Da |
| Monoisotopic Mass | 241.046 Da |
| Topological Polar Surface Area | 54.400 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 381.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |