Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P169323-250mg
|
250mg |
3
|
$35.90
|
|
|
P169323-1g
|
1g |
2
|
$68.90
|
|
| Synonyms | 2,4-Dicyanopyridine | 2,4-Pyridinedicarbonitrile, 97% | FT-0638837 | J-524112 | SCHEMBL995799 | YSWG444 | EINECS 249-492-0 | methyl?4-cyclopropylbenzoate | HJ2X384UBJ | AKOS015892293 | Pyridine-2,4-dicarbonitrile | UNII-HJ2X384UBJ | 2,4-Pyridinedicarbonit |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Heteroaromatic compounds Nitriles Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine - Heteroaromatic compound - Azacycle - Nitrile - Carbonitrile - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504756828 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756828 |
| IUPAC Name | pyridine-2,4-dicarbonitrile |
| INCHI | InChI=1S/C7H3N3/c8-4-6-1-2-10-7(3-6)5-9/h1-3H |
| InChIKey | HLAGQMFURMNTLW-UHFFFAOYSA-N |
| Smiles | C1=CN=C(C=C1C#N)C#N |
| Isomeric SMILES | C1=CN=C(C=C1C#N)C#N |
| WGK Germany | 3 |
| PubChem CID | 120144 |
| Molecular Weight | 129.12 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 04, 2024 | P169323 |
| Molecular Weight | 129.120 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 129.033 Da |
| Monoisotopic Mass | 129.033 Da |
| Topological Polar Surface Area | 60.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 203.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |