Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M178925-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,566.90
|
|
Discover 2-(4-Methoxybenzyloxy)-5-(trifluoromethyl)pyridine by Aladdin Scientific in 98% for only $1,566.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(4-METHOXYBENZYLOXY)-5-(TRIFLUOROMETHYL)PYRIDINE | 1033202-62-8 | 2-[(4-methoxyphenyl)methoxy]-5-(trifluoromethyl)pyridine | SCHEMBL16838859 | DTXSID70674454 | MFCD10699714 | AKOS015852059 | BS-22750 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Alkyl aryl ethers Pyridines and derivatives Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Alkyl aryl ether - Monocyclic benzene moiety - Pyridine - Heteroaromatic compound - Organoheterocyclic compound - Ether - Azacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Hydrocarbon derivative - Organic oxygen compound - Alkyl halide - Alkyl fluoride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]-5-(trifluoromethyl)pyridine |
|---|---|
| INCHI | InChI=1S/C14H12F3NO2/c1-19-12-5-2-10(3-6-12)9-20-13-7-4-11(8-18-13)14(15,16)17/h2-8H,9H2,1H3 |
| InChIKey | ACZASXZHQDCDLJ-UHFFFAOYSA-N |
| Smiles | COC1=CC=C(C=C1)COC2=NC=C(C=C2)C(F)(F)F |
| Isomeric SMILES | COC1=CC=C(C=C1)COC2=NC=C(C=C2)C(F)(F)F |
| PubChem CID | 46738803 |
| Molecular Weight | 283.2 |
| Molecular Weight | 283.240 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Exact Mass | 283.082 Da |
| Monoisotopic Mass | 283.082 Da |
| Topological Polar Surface Area | 31.400 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 291.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |