Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D154336-5g
|
5g |
3
|
$19.90
|
|
|
D154336-25g
|
25g |
1
|
$69.90
|
|
| Synonyms | 2,4-DIMETHOXYANILINE [HSDB] | Z104478344 | BRN 0638704 | DTXSID7043829 | WLN: 1OR BZ EO1 | 2, 4-dimethoxyaniline | DTXCID5023829 | EN300-20474 | HSDB 4125 | NCGC00248966-01 | EINECS 220-355-7 | CCG-302548 | Potassiumtartratehemihydrate | 2,4-Domethoxyanil |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
| Product Description |
Product Application: Various 2,4-dimethoxyphenylsemicarbazones were synthesized starting from 2,4-dimethoxyaniline via a phenylcarbamate intermediate. The hydrochloride of 2,4-dimethoxyaniline was prepared by intro- ducing hydrogen chloride gas into an etheral solution and washing the precipitate with absolute diethyl ether |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Methoxybenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dimethoxybenzenes |
| Alternative Parents | Methoxyanilines Aminophenyl ethers Phenoxy compounds Anisoles Alkyl aryl ethers Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | M-dimethoxybenzene - Dimethoxybenzene - Aminophenyl ether - Methoxyaniline - Phenoxy compound - Anisole - Phenol ether - Aniline or substituted anilines - Alkyl aryl ether - Ether - Primary amine - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organic oxygen compound - Amine - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,4-dimethoxyaniline |
|---|---|
| INCHI | InChI=1S/C8H11NO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,9H2,1-2H3 |
| InChIKey | GEQNZVKIDIPGCO-UHFFFAOYSA-N |
| Smiles | COC1=CC(=C(C=C1)N)OC |
| Isomeric SMILES | COC1=CC(=C(C=C1)N)OC |
| RTECS | BX4200000 |
| UN Number | 2811 |
| Packing Group | I |
| Molecular Weight | 153.18 |
| Beilstein | 13(3)2123 |
| Reaxy-Rn | 638704 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=638704&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 13, 2024 | D154336 | |
| Certificate of Analysis | Jan 13, 2024 | D154336 | |
| Certificate of Analysis | Jan 13, 2024 | D154336 | |
| Certificate of Analysis | Jan 13, 2024 | D154336 |
| Solubility | Slightly soluble in water(7g/L). |
|---|---|
| Sensitivity | light sensitive,air sensitive |
| Flash Point(°F) | 230°F |
| Flash Point(°C) | >110℃ |
| Melt Point(°C) | 32-37℃ |
| Molecular Weight | 153.180 g/mol |
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 153.079 Da |
| Monoisotopic Mass | 153.079 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 119.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |