Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D190359-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$748.90
|
|
| Synonyms | 2,4-Dichloro-7,7-dimethyl-5,7-dihydrofuro[3,4-d]pyrimidine | 1260088-72-9 | 2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine | MFCD19688042 | Furo[3,4-d]pyrimidine, 2,4-dichloro-5,7-dihydro-7,7-dimethyl- | SCHEMBL2707029 | 2,4-dichloro-7,7-dimethyl-5H,7H-furo[3,4-d |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Halopyrimidines |
| Direct Parent | 2-halopyrimidines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 2-halopyrimidine - Aryl chloride - Aryl halide - Heteroaromatic compound - Dialkyl ether - Ether - Oxacycle - Azacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-halopyrimidines. These are aromatic compounds containing a pyrimidine ring substituted at the 2-position with a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine |
|---|---|
| INCHI | InChI=1S/C8H8Cl2N2O/c1-8(2)5-4(3-13-8)6(9)12-7(10)11-5/h3H2,1-2H3 |
| InChIKey | IGGHWEUEJMUGHP-UHFFFAOYSA-N |
| Smiles | CC1(C2=C(CO1)C(=NC(=N2)Cl)Cl)C |
| Isomeric SMILES | CC1(C2=C(CO1)C(=NC(=N2)Cl)Cl)C |
| Molecular Weight | 219.07 |
| Reaxy-Rn | 20937608 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=20937608&ln= |
| Molecular Weight | 219.060 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 218.001 Da |
| Monoisotopic Mass | 218.001 Da |
| Topological Polar Surface Area | 35.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 212.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |