Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D179707-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,854.90
|
|
| Synonyms | 2,4-Dibromonicotinonitrile | 1152617-14-5 | 2,4-dibromopyridine-3-carbonitrile | 3-Pyridinecarbonitrile, 2,4-dibromo- | MFCD22041881 | 2,4-Dibromo-nicotinonitrile | SCHEMBL565956 | QQRBWXRCIWAXAU-UHFFFAOYSA-N | CWB61714 | BS-19463 | SY285973 | CS-0196520 | EN300-153996 | S11304 | A8 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | 3-pyridinecarbonitriles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 3-pyridinecarbonitriles |
| Alternative Parents | Polyhalopyridines 2-halopyridines Aryl bromides Heteroaromatic compounds Nitriles Azacyclic compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - 3-pyridinecarbonitrile - 2-halopyridine - Aryl bromide - Aryl halide - Heteroaromatic compound - Carbonitrile - Nitrile - Azacycle - Organobromide - Organohalogen compound - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Cyanide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 3-pyridinecarbonitriles. These are organic compounds containing a pyridine ring substituted at the 3-position by a carbonitrile group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,4-dibromopyridine-3-carbonitrile |
|---|---|
| INCHI | InChI=1S/C6H2Br2N2/c7-5-1-2-10-6(8)4(5)3-9/h1-2H |
| InChIKey | QQRBWXRCIWAXAU-UHFFFAOYSA-N |
| Smiles | C1=CN=C(C(=C1Br)C#N)Br |
| Isomeric SMILES | C1=CN=C(C(=C1Br)C#N)Br |
| Molecular Weight | 261.9 |
| Reaxy-Rn | 19182348 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=19182348&ln= |
| Molecular Weight | 261.899 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 261.856 Da |
| Monoisotopic Mass | 259.858 Da |
| Topological Polar Surface Area | 36.700 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 162.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |