Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B181568-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,295.90
|
|
|
B181568-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$5,886.90
|
|
| Synonyms | 2-(4-BROMOPHENYL)ETHANETHIOAMIDE | 147111-30-6 | 2-(4-Bromophenyl)thioacetamide | Benzeneethanethioamide, 4-bromo- | (4-Bromophenyl)ethanethioamide | SCHEMBL10968838 | DTXSID80513805 | YAXPTWNWOBQNPG-UHFFFAOYSA-N | XFA11130 | MFCD09809469 | STL301995 | AKOS000158350 | AS-5409 | SB |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bromobenzenes |
| Alternative Parents | Aryl bromides Thioamides Thiocarboxylic acid amides Thiocarbonyl compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Bromobenzene - Aryl halide - Aryl bromide - Thioamide - Thiocarboxylic acid amide - Organic nitrogen compound - Hydrocarbon derivative - Thiocarbonyl group - Organosulfur compound - Organonitrogen compound - Organobromide - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as bromobenzenes. These are organic compounds containing a bromine atom attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(4-bromophenyl)ethanethioamide |
|---|---|
| INCHI | InChI=1S/C8H8BrNS/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H2,10,11) |
| InChIKey | YAXPTWNWOBQNPG-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1CC(=S)N)Br |
| Isomeric SMILES | C1=CC(=CC=C1CC(=S)N)Br |
| Molecular Weight | 230.1 |
| Reaxy-Rn | 3240690 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3240690&ln= |
| Molecular Weight | 230.130 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 228.956 Da |
| Monoisotopic Mass | 228.956 Da |
| Topological Polar Surface Area | 58.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |