Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B186551-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,360.90
|
|
Discover 2-(4-Bromo-2,6-difluorophenyl)-1,3-dioxolane by Aladdin Scientific in 96% for only $2,360.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(4-BROMO-2,6-DIFLUOROPHENYL)-1,3-DIOXOLANE | 773087-43-7 | MFCD06210010 | SCHEMBL20388652 | DTXSID30674793 | YFB08743 | AKOS015835520 | AS-18052 | SY254028 | CS-0193407 | A865299 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Bromobenzenes Aryl fluorides Aryl bromides 1,3-dioxolanes Oxacyclic compounds Acetals Organofluorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Bromobenzene - Fluorobenzene - Aryl bromide - Aryl fluoride - Aryl halide - Meta-dioxolane - Acetal - Oxacycle - Organoheterocyclic compound - Organooxygen compound - Organic oxygen compound - Hydrocarbon derivative - Organofluoride - Organohalogen compound - Organobromide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane |
|---|---|
| INCHI | InChI=1S/C9H7BrF2O2/c10-5-3-6(11)8(7(12)4-5)9-13-1-2-14-9/h3-4,9H,1-2H2 |
| InChIKey | WTFMOVNMFQDXNI-UHFFFAOYSA-N |
| Smiles | C1COC(O1)C2=C(C=C(C=C2F)Br)F |
| Isomeric SMILES | C1COC(O1)C2=C(C=C(C=C2F)Br)F |
| Molecular Weight | 265.1 |
| Reaxy-Rn | 37520856 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=37520856&ln= |
| Molecular Weight | 265.050 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 263.96 Da |
| Monoisotopic Mass | 263.96 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 187.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |