Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C178180-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$4,086.90
|
|
| Synonyms | 914360-88-6 | 2-(3-Chloropyrazin-2-yl)acetonitrile | 3-Chloro-2-pyrazineacetonitrile | MFCD15146238 | DTXSID60551760 | (3-Chloropyrazin-2-yl)acetonitrile | AMY16167 | 2-(3-Chloro-2-pyrazinyl)acetonitrile | AKOS016005609 | PB11137 | AS-34544 | SY097046 | CS-0052282 | FT-0770365 | EN3 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Nitriles Azacyclic compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Nitrile - Carbonitrile - Organic nitrogen compound - Cyanide - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazines. These are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(3-chloropyrazin-2-yl)acetonitrile |
|---|---|
| INCHI | InChI=1S/C6H4ClN3/c7-6-5(1-2-8)9-3-4-10-6/h3-4H,1H2 |
| InChIKey | QYOUXNLAVKGTBD-UHFFFAOYSA-N |
| Smiles | C1=CN=C(C(=N1)CC#N)Cl |
| Isomeric SMILES | C1=CN=C(C(=N1)CC#N)Cl |
| Molecular Weight | 153.57 |
| Reaxy-Rn | 10424230 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10424230&ln= |
| Molecular Weight | 153.570 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 153.009 Da |
| Monoisotopic Mass | 153.009 Da |
| Topological Polar Surface Area | 49.600 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 150.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |