Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D770538-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$85.90
|
|
|
D770538-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$231.90
|
|
|
D770538-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$866.90
|
|
| Specifications & Purity | ≥99% |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylmethane - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Alcohol - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,2-diphenylethanol |
|---|---|
| INCHI | InChI=1S/C14H14O/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-15H,11H2 |
| InChIKey | NYLOEXLAXYHOHH-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)C(CO)C2=CC=CC=C2 |
| Isomeric SMILES | C1=CC=C(C=C1)C(CO)C2=CC=CC=C2 |
| WGK Germany | 3 |
| PubChem CID | 74662 |
| Molecular Weight | 198.26 |
| Flash Point(°F) | >235.4 °F |
|---|---|
| Flash Point(°C) | 113℃ |
| Boil Point(°C) | 190-192°C |
| Melt Point(°C) | 53-56°C |
| Molecular Weight | 198.260 g/mol |
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 198.104 Da |
| Monoisotopic Mass | 198.104 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 148.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |