Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D184825-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$166.90
|
|
Discover 2,2-Dimethyl-1-m-tolylpropan-1-one by Aladdin Scientific in 95% for only $166.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3',2,2-TRIMETHYLPROPIOPHENONE | 50390-49-3 | 2,2-dimethyl-1-(3-methylphenyl)propan-1-one | 2,2-Dimethyl-1-m-tolylpropan-1-one | MFCD03841163 | SCHEMBL855152 | DTXSID60557989 | AKOS010014821 | 2,2-Dimethyl-1-m-tolyl-propan-1-one | AS-59757 | CS-0153234 | EN300-99150 | N12514 | Z513 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Phenylpropanes Benzoyl derivatives Aryl alkyl ketones Toluenes Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkyl-phenylketone - Phenylpropane - Aryl alkyl ketone - Benzoyl - Toluene - Benzenoid - Monocyclic benzene moiety - Organic oxide - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,2-dimethyl-1-(3-methylphenyl)propan-1-one |
|---|---|
| INCHI | InChI=1S/C12H16O/c1-9-6-5-7-10(8-9)11(13)12(2,3)4/h5-8H,1-4H3 |
| InChIKey | FIRWPECOXVVSRF-UHFFFAOYSA-N |
| Smiles | CC1=CC(=CC=C1)C(=O)C(C)(C)C |
| Isomeric SMILES | CC1=CC(=CC=C1)C(=O)C(C)(C)C |
| Molecular Weight | 176.3 |
| Reaxy-Rn | 2246360 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2246360&ln= |
| Molecular Weight | 176.250 g/mol |
|---|---|
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 176.12 Da |
| Monoisotopic Mass | 176.12 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 188.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |