Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D155921-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$11.90
|
|
|
D155921-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$44.90
|
|
|
D155921-500g
|
500g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$803.90
|
|
| Synonyms | BIYJJEWTEPSHGZ-UHFFFAOYSA-N | AKOS015838456 | EINECS 224-591-1 | InChI=1/C9H18O2/c1-7(2)9(8(3)4)10-5-6-11-9/h7-8H,5-6H2,1-4H3 | 1,3-Dioxolane, 2,2-diisopropyl- | SCHEMBL2628483 | DTXSID40196072 | FT-0609245 | Diisopropyldioxolan | Diisopropyl ketone ethyl |
|---|---|
| Specifications & Purity | ≥96%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Acetals |
| Direct Parent | Ketals |
| Alternative Parents | 1,3-dioxolanes Oxacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Ketal - Meta-dioxolane - Oxacycle - Organoheterocyclic compound - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as ketals. These are acetals derived from ketones by replacement of the oxo group by two hydrocarbyloxy groups R2C(OR)2 ( R not Hydrogen ). This term, once abandoned, has been reinstated as a subclass of acetals. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,2-di(propan-2-yl)-1,3-dioxolane |
|---|---|
| INCHI | InChI=1S/C9H18O2/c1-7(2)9(8(3)4)10-5-6-11-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | BIYJJEWTEPSHGZ-UHFFFAOYSA-N |
| Smiles | CC(C)C1(OCCO1)C(C)C |
| Isomeric SMILES | CC(C)C1(OCCO1)C(C)C |
| Molecular Weight | 158.24 |
| Reaxy-Rn | 1304863 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1304863&ln= |
| Refractive Index | 1.43 |
|---|---|
| Flash Point(°F) | 48°C(lit.) |
| Flash Point(°C) | 48°C(lit.) |
| Boil Point(°C) | 172°C |
| Molecular Weight | 158.240 g/mol |
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 158.131 Da |
| Monoisotopic Mass | 158.131 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 114.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |