Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B121840-1g
|
1g |
3
|
$157.90
|
|
|
B121840-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$388.90
|
|
| Synonyms | Bisphenol PH, analytical standard | NCGC00357017-01 | DTXSID9058654 | Tox21_303963 | 5,5'-Isopropylidenebis(2-hydroxybiphenyl) | DS-13671 | 4,4'-Isopropylidenebis(2-phenylphenol) | SCHEMBL17376966 | 4-[2-(4-oxidanyl-3-phenyl-phenyl)propan-2-yl]-2-phenyl-p |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Class | Diarylheptanoids |
| Subclass | Linear diarylheptanoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Linear diarylheptanoids |
| Alternative Parents | Bisphenols Biphenyls and derivatives Phenylpropanes 1-hydroxy-2-unsubstituted benzenoids Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Linear 1,7-diphenylheptane skeleton - Bisphenol - Diphenylmethane - Biphenyl - Phenylpropane - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Benzenoid - Monocyclic benzene moiety - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as linear diarylheptanoids. These are diarylheptanoids with an open heptane chain. The two aromatic rings are linked only by the heptane chain. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504767321 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767321 |
| IUPAC Name | 4-[2-(4-hydroxy-3-phenylphenyl)propan-2-yl]-2-phenylphenol |
| INCHI | InChI=1S/C27H24O2/c1-27(2,21-13-15-25(28)23(17-21)19-9-5-3-6-10-19)22-14-16-26(29)24(18-22)20-11-7-4-8-12-20/h3-18,28-29H,1-2H3 |
| InChIKey | BKTRENAPTCBBFA-UHFFFAOYSA-N |
| Smiles | CC(C)(C1=CC(=C(C=C1)O)C2=CC=CC=C2)C3=CC(=C(C=C3)O)C4=CC=CC=C4 |
| Isomeric SMILES | CC(C)(C1=CC(=C(C=C1)O)C2=CC=CC=C2)C3=CC(=C(C=C3)O)C4=CC=CC=C4 |
| Molecular Weight | 380.49 |
| Reaxy-Rn | 5117041 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5117041&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 19, 2022 | B121840 |
| Solubility | Soluble in Methanol |
|---|---|
| Melt Point(°C) | 118°C |
| Molecular Weight | 380.500 g/mol |
| XLogP3 | 7.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 380.178 Da |
| Monoisotopic Mass | 380.178 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 459.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |