Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D188542-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$677.90
|
|
Discover 2-(2,2-Dimethyl-propionylamino)-n-methoxy-n-methyl-isonicotinamide by Aladdin Scientific in 95% for only $677.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(2,2-Dimethyl-propionylamino)-N-methoxy-N-methyl-isonicotinamide | 946681-81-8 | 2-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-4-carboxamide | DTXSID501140593 | WMB68181 | MFCD08235122 | AKOS015841153 | AB43756 | N-METHOXY-N-METHYL-2-PIVALAMIDOISONICOTINAMI |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyridinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridinecarboxamides |
| Alternative Parents | N-arylamides Imidolactams Heteroaromatic compounds Secondary carboxylic acid amides Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridinecarboxamide - N-arylamide - Imidolactam - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Azacycle - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridinecarboxamides. These are compounds containing a pyridine ring bearing a carboxamide. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-4-carboxamide |
|---|---|
| INCHI | InChI=1S/C13H19N3O3/c1-13(2,3)12(18)15-10-8-9(6-7-14-10)11(17)16(4)19-5/h6-8H,1-5H3,(H,14,15,18) |
| InChIKey | ZECTXKVADDIPOY-UHFFFAOYSA-N |
| Smiles | CC(C)(C)C(=O)NC1=NC=CC(=C1)C(=O)N(C)OC |
| Isomeric SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)C(=O)N(C)OC |
| PubChem CID | 24229161 |
| Molecular Weight | 265.3 |
| Molecular Weight | 265.310 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 265.143 Da |
| Monoisotopic Mass | 265.143 Da |
| Topological Polar Surface Area | 71.500 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 339.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |