Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M171650-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$569.90
|
|
| Synonyms | 101257-32-3 | 2-(1-METHYLPIPERIDIN-3-YL)ETHAN-1-OL | 2-(1-methylpiperidin-3-yl)ethanol | 2-(1-METHYL-3-PIPERIDINYL)-1-ETHANOL | 3-Piperidineethanol, 1-methyl- | 1-METHYLPIPERIDINE-3-ETHANOL | SCHEMBL1099315 | CHEMBL4517631 | DTXSID90617141 | PLZATTBQOOIXMS-UHFFFAOYSA-N | BEA |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Trialkylamines Azacyclic compounds Primary alcohols Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 2-(1-methylpiperidin-3-yl)ethanol |
|---|---|
| INCHI | InChI=1S/C8H17NO/c1-9-5-2-3-8(7-9)4-6-10/h8,10H,2-7H2,1H3 |
| InChIKey | PLZATTBQOOIXMS-UHFFFAOYSA-N |
| Smiles | CN1CCCC(C1)CCO |
| Isomeric SMILES | CN1CCCC(C1)CCO |
| Molecular Weight | 143.23 |
| Reaxy-Rn | 104077 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=104077&ln= |
| Molecular Weight | 143.230 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 143.131 Da |
| Monoisotopic Mass | 143.131 Da |
| Topological Polar Surface Area | 23.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 95.300 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |