Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M173627-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,036.90
|
|
| Synonyms | 2-(1-Methylazetidin-3-yl)ethanol | 1363381-66-1 | 1-Methyl-3-(hydroxyethyl)azetidine | 2-(1-methylazetidin-3-yl)ethan-1-ol | 3-Azetidineethanol, 1-methyl- | SCHEMBL12535990 | DTXSID10733453 | MFCD21641987 | AKOS016006292 | PB13968 | AS-33509 | CS-0052322 | FT-0684761 | EN300-12506 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azetidines |
| Alternative Parents | Trialkylamines Azacyclic compounds Primary alcohols Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Tertiary aliphatic amine - Tertiary amine - Azetidine - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as azetidines. These are organic compounds containing a saturated four-member heterocycle where one nitrogen atom replaces a carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(1-methylazetidin-3-yl)ethanol |
|---|---|
| INCHI | InChI=1S/C6H13NO/c1-7-4-6(5-7)2-3-8/h6,8H,2-5H2,1H3 |
| InChIKey | XUCLCYHNWRAQJA-UHFFFAOYSA-N |
| Smiles | CN1CC(C1)CCO |
| Isomeric SMILES | CN1CC(C1)CCO |
| Molecular Weight | 115.176 |
| Reaxy-Rn | 37907295 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=37907295&ln= |
| Molecular Weight | 115.170 g/mol |
|---|---|
| XLogP3 | 0.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 115.1 Da |
| Monoisotopic Mass | 115.1 Da |
| Topological Polar Surface Area | 23.500 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 68.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |