Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S300499-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$243.90
|
|
| Synonyms | (1S,2S)-(+)-2-BENZYLOXYCYCLOHEXYL ISOTHIOCYANATE | 737000-89-4 | [(1S,2S)-2-isothiocyanatocyclohexyl]oxymethylbenzene | SCHEMBL14091847 | DTXSID10474516 | MFCD05664047 | BP-12377 | BS-22442 | (1S,2S)-(+)-2-BENZYLOXYCYCLOHEXYLISOTHIOCYANATE |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzylethers |
| Alternative Parents | Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Dialkyl ethers Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzylether - Isothiocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Ether - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzylethers. These are aromatic ethers with the general formula ROCR' (R = alkyl, aryl; R'=benzene). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [(1S,2S)-2-isothiocyanatocyclohexyl]oxymethylbenzene |
|---|---|
| INCHI | InChI=1S/C14H17NOS/c17-11-15-13-8-4-5-9-14(13)16-10-12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-10H2/t13-,14-/m0/s1 |
| InChIKey | DNRPSBSMXLYTQF-KBPBESRZSA-N |
| Smiles | C1CCC(C(C1)N=C=S)OCC2=CC=CC=C2 |
| Isomeric SMILES | C1CC[C@@H]([C@H](C1)N=C=S)OCC2=CC=CC=C2 |
| PubChem CID | 11863573 |
| Molecular Weight | 247.36 |
| Melt Point(°C) | 33-36°C |
|---|---|
| Molecular Weight | 247.360 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 247.103 Da |
| Monoisotopic Mass | 247.103 Da |
| Topological Polar Surface Area | 53.700 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 269.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |