Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M630920-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$232.90
|
|
|
M630920-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$372.90
|
|
|
M630920-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$620.90
|
|
|
M630920-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,118.90
|
|
| Synonyms | [(1S)-2,2-difluorocyclopropyl]methanol | 1887036-19-2 | (S)-(2,2-difluorocyclopropyl)methanol | SCHEMBL17583916 | MFCD31695798 | AS-84480 | P18897 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| IUPAC Name | [(1S)-2,2-difluorocyclopropyl]methanol |
|---|---|
| INCHI | InChI=1S/C4H6F2O/c5-4(6)1-3(4)2-7/h3,7H,1-2H2/t3-/m0/s1 |
| InChIKey | XOLSMTBBIZDHSG-VKHMYHEASA-N |
| Smiles | C1C(C1(F)F)CO |
| Isomeric SMILES | C1[C@H](C1(F)F)CO |
| Molecular Weight | 108.09 |
| Reaxy-Rn | 9254463 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9254463&ln= |
| Molecular Weight | 108.090 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 108.039 Da |
| Monoisotopic Mass | 108.039 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 81.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |