Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R464124-1ml
|
1ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$553.90
|
|
| Synonyms | (+)-trans-Isolimonene | CHEBI:90014 | TWCNAXRPQBLSNO-UWVGGRQHSA-N | (3R,6R)-3-methyl-6-prop-1-en-2-ylcyclohexene | Cyclohexene, 3-methyl-6-(1-methylethenyl)-, (3R-trans)- | EINECS 225-843-3 | (3r-trans)-3-methyl-6-(1-methylethenyl) cyclohexene | p-Mentha- |
|---|---|
| Specifications & Purity | ≥95%(GC), sum of enantiomers |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Menthane monoterpenoids |
| Alternative Parents | Monocyclic monoterpenoids Branched unsaturated hydrocarbons Cycloalkenes Unsaturated aliphatic hydrocarbons |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | P-menthane monoterpenoid - Monocyclic monoterpenoid - Branched unsaturated hydrocarbon - Cycloalkene - Cyclic olefin - Unsaturated aliphatic hydrocarbon - Unsaturated hydrocarbon - Olefin - Hydrocarbon - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as menthane monoterpenoids. These are monoterpenoids with a structure based on the o-, m-, or p-menthane backbone. P-menthane consists of the cyclohexane ring with a methyl group and a (2-methyl)-propyl group at the 1 and 4 ring position, respectively. The o- and m- menthanes are much rarer, and presumably arise by alkyl migration of p-menthanes. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3R,6R)-3-methyl-6-prop-1-en-2-ylcyclohexene |
|---|---|
| INCHI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,9-10H,1,5,7H2,2-3H3/t9-,10-/m0/s1 |
| InChIKey | TWCNAXRPQBLSNO-UWVGGRQHSA-N |
| Smiles | CC1CCC(C=C1)C(=C)C |
| Isomeric SMILES | C[C@@H]1CC[C@H](C=C1)C(=C)C |
| WGK Germany | 3 |
| PubChem CID | 78790 |
| Molecular Weight | 136.23 |
| Flash Point(°F) | 102.2 °F |
|---|---|
| Flash Point(°C) | 39 °C |
| Molecular Weight | 136.230 g/mol |
| XLogP3 | 4.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 136.125 Da |
| Monoisotopic Mass | 136.125 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 153.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |