Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I634381-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$145.90
|
|
|
I634381-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$218.90
|
|
|
I634381-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$387.90
|
|
|
I634381-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$581.90
|
|
|
I634381-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,911.90
|
|
| Synonyms | (1R,2R)-2-iodocyclopropanecarboxylic acid | 692288-05-4 | (1R,2R)-2-iodocyclopropane-1-carboxylic acid | MFCD26404042 | SCHEMBL7874044 | AMY5812 | CS3132 | AKOS025117283 | (1R,2R)-2-iodocyclopropanecarboxylicacid | AC-31163 | AS-46624 | Cyclopropanecarbox |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| IUPAC Name | (1R,2R)-2-iodocyclopropane-1-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C4H5IO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3+/m0/s1 |
| InChIKey | JLDDIEQQVGNSGM-STHAYSLISA-N |
| Smiles | C1C(C1I)C(=O)O |
| Isomeric SMILES | C1[C@@H]([C@@H]1I)C(=O)O |
| PubChem CID | 11206614 |
| Molecular Weight | 211.99 |
| Molecular Weight | 211.990 g/mol |
|---|---|
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 211.933 Da |
| Monoisotopic Mass | 211.933 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 102.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |