Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C633576-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$199.90
|
|
|
C633576-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$801.90
|
|
|
C633576-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,601.90
|
|
| Synonyms | 1I7WE95HOJ | PS-16567 | Cyclohexanemethanol, alpha-methyl-, (alphaR)- | (R)-1-Cyclohexylethan-1-ol | AKOS011390957 | EN300-89233 | SCHEMBL1053407 | (1R)-1-cyclohexylethan-1-ol | 1-Cyclohexylethanol, (R)- | DTXSID201302413 | (R)-1-cyclohexylethanol | JMSUN |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Secondary alcohols |
| Alternative Parents | Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Secondary alcohol - Hydrocarbon derivative - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as secondary alcohols. These are compounds containing a secondary alcohol functional group, with the general structure HOC(R)(R') (R,R'=alkyl, aryl). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1R)-1-cyclohexylethanol |
|---|---|
| INCHI | InChI=1S/C8H16O/c1-7(9)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | JMSUNAQVHOHLMX-SSDOTTSWSA-N |
| Smiles | CC(C1CCCCC1)O |
| Isomeric SMILES | C[C@H](C1CCCCC1)O |
| Alternate CAS | 3113-99-3 |
| Molecular Weight | 128.21 |
| Reaxy-Rn | 2322053 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2322053&ln= |
| Molecular Weight | 128.210 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 128.12 Da |
| Monoisotopic Mass | 128.12 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 74.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |