Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H172061-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$119.90
|
|
Discover 1H-pyrrolo[3,2-b]pyridin-4-ium-4-olate by Aladdin Scientific in 97% for only $119.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1H-Pyrrolo[3,2-b]pyridine 4-oxide | 1116136-36-7 | 1H-pyrrolo[3,2-b]pyridin-4-ium-4-olate | 4-hydroxypyrrolo[3,2-b]pyridine | 1h-pyrrolo[3,2-b]pyridine4-oxide | MFCD12827548 | SCHEMBL3624899 | SCHEMBL4490839 | DTXSID40680527 | HULGTKORTOGPHW-UHFFFAOYSA-N | 4-hydroxypyrrolo[3 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyridines |
| Alternative Parents | Pyridines and derivatives Pyrroles Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyridine - Pyridine - Heteroaromatic compound - Pyrrole - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyridines. These are compounds containing a pyrrolopyridine moiety, which consists of a pyrrole ring fused to a pyridine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-hydroxypyrrolo[3,2-b]pyridine |
|---|---|
| INCHI | InChI=1S/C7H6N2O/c10-9-5-1-2-6-7(9)3-4-8-6/h1-5,10H |
| InChIKey | ORPVDSROZJCYDT-UHFFFAOYSA-N |
| Smiles | C1=CN(C2=CC=NC2=C1)O |
| Isomeric SMILES | C1=CN(C2=CC=NC2=C1)O |
| PubChem CID | 52911127 |
| Molecular Weight | 134.138 |
| Molecular Weight | 134.140 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 134.048 Da |
| Monoisotopic Mass | 134.048 Da |
| Topological Polar Surface Area | 38.100 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 129.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |