Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H171925-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,106.90
|
|
Discover 1H-pyrrolo[2,3-c]pyridine-5-carbonitrile by Aladdin Scientific in 97% for only $3,106.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1H-pyrrolo[2,3-c]pyridine-5-carbonitrile | 1082041-09-5 | 5-CYANO-6-AZAINDOLE | MFCD11845540 | SCHEMBL3831376 | DTXSID00676825 | AMY34618 | AKOS016001761 | PB17855 | AS-50829 | SY097812 | CS-0052495 | FT-0654409 | P11204 | EN300-4269271 | A801823 | Z1255466100 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyridines |
| Alternative Parents | Pyridines and derivatives Pyrroles Heteroaromatic compounds Nitriles Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyridine - Pyridine - Heteroaromatic compound - Pyrrole - Azacycle - Nitrile - Carbonitrile - Organic nitrogen compound - Cyanide - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyridines. These are compounds containing a pyrrolopyridine moiety, which consists of a pyrrole ring fused to a pyridine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1H-pyrrolo[2,3-c]pyridine-5-carbonitrile |
|---|---|
| INCHI | InChI=1S/C8H5N3/c9-4-7-3-6-1-2-10-8(6)5-11-7/h1-3,5,10H |
| InChIKey | HJFIVMKPHXFLBV-UHFFFAOYSA-N |
| Smiles | C1=CNC2=CN=C(C=C21)C#N |
| Isomeric SMILES | C1=CNC2=CN=C(C=C21)C#N |
| Molecular Weight | 143.149 |
| Reaxy-Rn | 32517098 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=32517098&ln= |
| Molecular Weight | 143.150 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 143.048 Da |
| Monoisotopic Mass | 143.048 Da |
| Topological Polar Surface Area | 52.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 193.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |