Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M157876-250mg
|
250mg |
3
|
$34.90
|
|
|
M157876-1g
|
1g |
2
|
$105.90
|
|
| Synonyms | 10-METHYL-9-PHENYLACRIDIN-10-IUM PERCHLORATE | T72368 | AS-81213 | M1775 | AKOS015843773 | SCHEMBL156599 | 10-methyl-9phenyl-10-acridinium perchlorate | MFCD09038537 | 10-methyl-9-phenylacridin-10-ium;perchlorate | DTXSID20462489 | 10-Methyl-9-phenylacrid |
|---|---|
| Specifications & Purity | ≥98%(HPLC)(N) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Phenylquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylquinolines |
| Alternative Parents | Acridines Phenylpyridines Pyridinium derivatives Organic perchlorates Organic perchlorate salts Benzene and substituted derivatives Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Phenylquinoline - Acridine - Benzoquinoline - 4-phenylpyridine - Monocyclic benzene moiety - Organic perchlorate - Pyridine - Pyridinium - Benzenoid - Organic perchlorate salt - Heteroaromatic compound - Organic chlorate - Azacycle - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organic salt - Organic cation - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylquinolines. These are heterocyclic compounds containing a quinoline moiety substituted with a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 10-methyl-9-phenylacridin-10-ium;perchlorate |
|---|---|
| INCHI | InChI=1S/C20H16N.ClHO4/c1-21-18-13-7-5-11-16(18)20(15-9-3-2-4-10-15)17-12-6-8-14-19(17)21;2-1(3,4)5/h2-14H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NRNCXGCGIKATGE-UHFFFAOYSA-M |
| Smiles | C[N+]1=C2C=CC=CC2=C(C3=CC=CC=C31)C4=CC=CC=C4.[O-]Cl(=O)(=O)=O |
| Isomeric SMILES | C[N+]1=C2C=CC=CC2=C(C3=CC=CC=C31)C4=CC=CC=C4.[O-]Cl(=O)(=O)=O |
| PubChem CID | 11326154 |
| Molecular Weight | 369.8 |
| Beilstein | 20(3/4)4356 |
| Reaxy-Rn | 3840223 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 06, 2024 | M157876 | |
| Certificate of Analysis | Jun 30, 2022 | M157876 | |
| Certificate of Analysis | Jun 30, 2022 | M157876 |
| Solubility | Soluble in Acetone |
|---|---|
| Molecular Weight | 369.800 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 369.077 Da |
| Monoisotopic Mass | 369.077 Da |
| Topological Polar Surface Area | 78.200 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 418.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |