Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B405241-250mg
|
250mg |
3
|
$171.90
|
|
|
B405241-1g
|
1g |
5
|
$480.90
|
|
| Synonyms | 10H-phenothiazine, 10-(4-bromophenyl)- | MFCD21609447 | 10-(4-bromophenyl)phenothiazine | 10-(4-Bromophenyl)phenothiazine (contains 10% 10-(4-Iodophenyl)phenothiazine at maximum) | KOLVTMISRQOMPW-UHFFFAOYSA-N | T71163 | B5374 | SCHEMBL1022593 | 10-(4-brom |
|---|---|
| Specifications & Purity | ≥90% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Triarylamines |
| Alternative Parents | Phenothiazines Diarylthioethers Aniline and substituted anilines Bromobenzenes Aryl bromides 1,4-thiazines Azacyclic compounds Organopnictogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Tertiary aromatic amine - Phenothiazine - Diarylthioether - Benzothiazine - Aniline or substituted anilines - Aryl thioether - Halobenzene - Bromobenzene - Benzenoid - Aryl bromide - Aryl halide - Monocyclic benzene moiety - Para-thiazine - Organoheterocyclic compound - Azacycle - Thioether - Hydrocarbon derivative - Organohalogen compound - Organobromide - Organopnictogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as triarylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three aryl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504759660 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759660 |
| IUPAC Name | 10-(4-bromophenyl)phenothiazine |
| INCHI | InChI=1S/C18H12BrNS/c19-13-9-11-14(12-10-13)20-15-5-1-3-7-17(15)21-18-8-4-2-6-16(18)20/h1-12H |
| InChIKey | KOLVTMISRQOMPW-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)C4=CC=C(C=C4)Br |
| Isomeric SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)C4=CC=C(C=C4)Br |
| Molecular Weight | 354.27 |
| Reaxy-Rn | 920369 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=920369&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 10, 2022 | B405241 | |
| Certificate of Analysis | Oct 10, 2022 | B405241 | |
| Certificate of Analysis | Oct 10, 2022 | B405241 |
| Melt Point(°C) | 134 °C |
|---|---|
| Molecular Weight | 354.300 g/mol |
| XLogP3 | 6.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 352.987 Da |
| Monoisotopic Mass | 352.987 Da |
| Topological Polar Surface Area | 28.500 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 333.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |