Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B290633-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$7,403.90
|
|
| Synonyms | 10-(4-BROMOPHENYL)-10H-PHENOXAZINE | 71041-21-9 | 10H-Phenoxazine, 10-(4-bromophenyl)- | 10-(4-BROMOPHENYL)PHENOXAZINE | starbld0019001 | SCHEMBL15472193 | DTXSID20533744 | 10-(4-Bromo-phenyl)-10H-phenoxazine | 10H-Phenoxazine,10-(4-bromophenyl)- | AS-81892 | E85529 | A934161 |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Triarylamines |
| Alternative Parents | N-substituted phenoxazines Diarylethers Aniline and substituted anilines Bromobenzenes Aryl bromides Oxacyclic compounds Azacyclic compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Tertiary aromatic amine - N-substituted phenoxazine - Phenoxazine - Diaryl ether - Aniline or substituted anilines - Bromobenzene - Halobenzene - Aryl bromide - Aryl halide - Monocyclic benzene moiety - Benzenoid - Oxacycle - Azacycle - Organoheterocyclic compound - Ether - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organobromide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as triarylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three aryl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 10-(4-bromophenyl)phenoxazine |
|---|---|
| INCHI | InChI=1S/C18H12BrNO/c19-13-9-11-14(12-10-13)20-15-5-1-3-7-17(15)21-18-8-4-2-6-16(18)20/h1-12H |
| InChIKey | KHHIALZHPCMMMT-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C(=C1)N(C3=CC=CC=C3O2)C4=CC=C(C=C4)Br |
| Isomeric SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3O2)C4=CC=C(C=C4)Br |
| Reaxy-Rn | 24487 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=24487&ln= |
| Molecular Weight | 338.200 g/mol |
|---|---|
| XLogP3 | 5.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 337.01 Da |
| Monoisotopic Mass | 337.01 Da |
| Topological Polar Surface Area | 12.500 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 333.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |