Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T301083-1g
|
1g |
2
|
$85.90
|
|
|
T301083-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$333.90
|
|
Discover 1-(tert-Butyldimethylsilyl)imidazole [tert-Butyldimethylsilylating Agent] by Aladdin Scientific in 90% for only $85.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 54925-64-3 | 1-(tert-Butyldimethylsilyl)-1H-imidazole | 1-(tert-Butyldimethylsilyl)imidazole | tert-Butyldimethylsilylimidazole | N-tert-Butyldimethylsilylimidazole | tert-butyl-imidazol-1-yl-dimethylsilane | OV8B14J7IF | 1-(T-BUTYLDIMETHYLSILYL)IMIDAZOLE | 1H-Imidazole, |
|---|---|
| Specifications & Purity | ≥90% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
| Product Description |
1-(tert-Butyldimethylsilyl)imidazole is a reactive silylating agent. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | N-substituted imidazoles Trialkylheterosilanes Heteroaromatic compounds Organic metalloid salts N-silyl compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkylarylsilane - N-substituted imidazole - Azole - Imidazole - Trialkylheterosilane - Heteroaromatic compound - N-silyl compound - Organoheterosilane - Organoheterocyclic compound - Organic metalloid salt - Azacycle - Organic nitrogen compound - Organic salt - Organopnictogen compound - Organonitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl-imidazol-1-yl-dimethylsilane |
|---|---|
| INCHI | InChI=1S/C9H18N2Si/c1-9(2,3)12(4,5)11-7-6-10-8-11/h6-8H,1-5H3 |
| InChIKey | VUENSYJCBOSTCS-UHFFFAOYSA-N |
| Smiles | CC(C)(C)[Si](C)(C)N1C=CN=C1 |
| Isomeric SMILES | CC(C)(C)[Si](C)(C)N1C=CN=C1 |
| WGK Germany | 3 |
| PubChem CID | 171385 |
| Molecular Weight | 182.34 |
| Beilstein | 606695 |
| Reaxy-Rn | 606695 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 21, 2023 | T301083 |
| Sensitivity | Moisture sensitive. |
|---|---|
| Refractive Index | 1.48 |
| Flash Point(°F) | 210.2 °F |
| Flash Point(°C) | 81°C(lit.) |
| Boil Point(°C) | 155°C/77mmHg(lit.) |
| Molecular Weight | 182.340 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 182.124 Da |
| Monoisotopic Mass | 182.124 Da |
| Topological Polar Surface Area | 17.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 160.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |