Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P131286-1mg
|
1mg |
3
|
$20.90
|
|
|
P131286-5mg
|
5mg |
3
|
$84.90
|
|
|
P131286-25mg
|
25mg |
2
|
$353.90
|
|
| Synonyms | 12-(pyren-1-yl)dodecanoic acid | MFCD00080927 | 1-PYRENEDODECANOICACID | AS-60176 | 12-pyren-1-yldodecanoic acid | pyrene-dodecanoic acid | 12-Pdda | DTXSID00219216 | J-100227 | 12-(pyren-1-yl)dodecanoicacid | 1-Pyrenedodecanoic acid, suitable for fluores |
|---|---|
| Specifications & Purity | for fluorescence analysis, ≥98%(HPLC) |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Grade | for fluorescence analysis |
| Product Description |
1-pyrenedodecanoic acid is a fluorescent fatty acid analog used as a probe in FCM to study the uptake of fluorescent fatty acids into cultured cells. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Pyrenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrenes |
| Alternative Parents | Phenanthrenes and derivatives Long-chain fatty acids Naphthalenes Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Pyrene - Phenanthrene - Long-chain fatty acid - Naphthalene - Fatty acyl - Fatty acid - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrenes. These are compounds containing a pyrene moiety, which consists four fused benzene rings, resulting in a flat aromatic system. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504756741 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756741 |
| IUPAC Name | 12-pyren-1-yldodecanoic acid |
| INCHI | InChI=1S/C28H32O2/c29-26(30)14-9-7-5-3-1-2-4-6-8-11-21-15-16-24-18-17-22-12-10-13-23-19-20-25(21)28(24)27(22)23/h10,12-13,15-20H,1-9,11,14H2,(H,29,30) |
| InChIKey | JORFLUCVQONOPN-UHFFFAOYSA-N |
| Smiles | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCCCCCCCCCC(=O)O |
| Isomeric SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCCCCCCCCCC(=O)O |
| WGK Germany | 3 |
| Molecular Weight | 400.552 |
| Beilstein | 2481235 |
| Reaxy-Rn | 2481235 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2481235&ln= |
| Molecular Weight | 400.600 g/mol |
|---|---|
| XLogP3 | 9.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 12 |
| Exact Mass | 400.24 Da |
| Monoisotopic Mass | 400.24 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 529.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |