Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M178289-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$4,051.90
|
|
| Synonyms | 1-methylazepan-4-amine | 933741-93-6 | 4-Amino-1-methyl-hexahydro-1H-azepine | MFCD17015865 | 4-Amino-1-methylazepane | SCHEMBL12233404 | DTXSID60680584 | AKOS014320332 | PB18198 | AS-33424 | SY097559 | AM20120348 | CS-0052429 | FT-0684690 | EN300-203536 | A844561 | J-504988 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azepanes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azepanes |
| Alternative Parents | Trialkylamines Azacyclic compounds Organopnictogen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Azepane - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as azepanes. These are organic compounds containing a saturated seven member heterocycle, with one nitrogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-methylazepan-4-amine |
|---|---|
| INCHI | InChI=1S/C7H16N2/c1-9-5-2-3-7(8)4-6-9/h7H,2-6,8H2,1H3 |
| InChIKey | LYRZFDLVKYYDOX-UHFFFAOYSA-N |
| Smiles | CN1CCCC(CC1)N |
| Isomeric SMILES | CN1CCCC(CC1)N |
| Molecular Weight | 128.219 |
| Reaxy-Rn | 23621622 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=23621622&ln= |
| Molecular Weight | 128.220 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 128.131 Da |
| Monoisotopic Mass | 128.131 Da |
| Topological Polar Surface Area | 29.300 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 83.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |