Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M425610-1ml
|
1ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$112.90
|
|
| Synonyms | 70505-90-7 | 1'-Methylspiro[chroman-2,4'-piperidin]-4-amine hydrochloride | 1'-methyl-3,4-dihydrospiro[chromene-2,4'-piperidin]-4-amine hydrochloride | 1193389-01-3 | 1'-Methylspiro[chromane-2,4'-piperidin]-4-amine hydrochloride | 1'-methyl-3,4-dihydrospiro[1-benzo |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In |
Dry ice packs + Cold packs This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-benzopyrans |
| Alternative Parents | Aralkylamines Alkyl aryl ethers Piperidines Benzenoids Trialkylamines Oxacyclic compounds Azacyclic compounds Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1-benzopyran - Alkyl aryl ether - Aralkylamine - Piperidine - Benzenoid - Tertiary amine - Tertiary aliphatic amine - Ether - Oxacycle - Azacycle - Hydrocarbon derivative - Primary amine - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Organic nitrogen compound - Amine - Hydrochloride - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1-benzopyrans. These are organic aromatic compounds that 1-benzopyran, a bicyclic compound made up of a benzene ring fused to a pyran, so that the oxygen atom is at the 1-position. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C14H20N2O.ClH/c1-16-8-6-14(7-9-16)10-12(15)11-4-2-3-5-13(11)17-14;/h2-5,12H,6-10,15H2,1H3;1H |
| InChIKey | NNVNAJGCZFCILW-UHFFFAOYSA-N |
| Smiles | CN1CCC2(CC1)CC(C3=CC=CC=C3O2)N.Cl |
| Isomeric SMILES | CN1CCC2(CC1)CC(C3=CC=CC=C3O2)N.Cl |
| PubChem CID | 43810428 |
| Molecular Weight | 268.782 |
| Molecular Weight | 268.780 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 268.134 Da |
| Monoisotopic Mass | 268.134 Da |
| Topological Polar Surface Area | 38.500 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |