Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E187965-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$62.90
|
|
|
E187965-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$196.90
|
|
Discover (1-Ethylpiperidin-4-yl)methanol by Aladdin Scientific in 95% for only $62.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | (1-ETHYLPIPERIDIN-4-YL)METHANOL | 90226-87-2 | (1-Ethyl-piperidin-4-yl)-methanol | (1-ethyl-4-piperidinyl)methanol | SCHEMBL1839093 | DTXSID50573517 | 1-Ethyl-4-hydroxymethylpiperidine | FLOQYJOORROJQU-UHFFFAOYSA-N | MFCD08059823 | AKOS005290757 | SB39739 | AC-25675 | DS-13632 | A |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Trialkylamines Azacyclic compounds Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1-ethylpiperidin-4-yl)methanol |
|---|---|
| INCHI | InChI=1S/C8H17NO/c1-2-9-5-3-8(7-10)4-6-9/h8,10H,2-7H2,1H3 |
| InChIKey | FLOQYJOORROJQU-UHFFFAOYSA-N |
| Smiles | CCN1CCC(CC1)CO |
| Isomeric SMILES | CCN1CCC(CC1)CO |
| WGK Germany | 3 |
| Molecular Weight | 143.23 |
| Reaxy-Rn | 1421510 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1421510&ln= |
| Molecular Weight | 143.230 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 143.131 Da |
| Monoisotopic Mass | 143.131 Da |
| Topological Polar Surface Area | 23.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 87.300 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |