Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E194032-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$9.90
|
|
| Synonyms | 1-Ethyl-7-nitro-1,2,3,4-tetrahydroquinoline | 57883-28-0 | N-ETHYL-7-NITRO-1,2,3,4-TETRAHYDROQUINOLINE | 1-ethyl-7-nitro-3,4-dihydro-2H-quinoline | MFCD07368631 | 1-Ethyl-7-nitro-1,2,3,4-tetrahydro- | 1-Ethyl-7-nitro-1,2,3,4-tetrahydro-quinoline | 7-Nitro-N-ethyl-1,2,3 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Nitroquinolines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitroquinolines and derivatives |
| Alternative Parents | Hydroquinolines Nitroaromatic compounds Dialkylarylamines Aralkylamines Benzenoids Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organic salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Nitroquinoline - Tetrahydroquinoline - Nitroaromatic compound - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aralkylamine - Benzenoid - C-nitro compound - Tertiary amine - Organic nitro compound - Organic oxoazanium - Azacycle - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Hydrocarbon derivative - Organonitrogen compound - Amine - Organic salt - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Organic cation - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroquinolines and derivatives. These are compounds containing a nitro group attached to a quinoline moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-ethyl-7-nitro-3,4-dihydro-2H-quinoline |
|---|---|
| INCHI | InChI=1S/C11H14N2O2/c1-2-12-7-3-4-9-5-6-10(13(14)15)8-11(9)12/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | TUCATNRJGJWEKT-UHFFFAOYSA-N |
| Smiles | CCN1CCCC2=C1C=C(C=C2)[N+](=O)[O-] |
| Isomeric SMILES | CCN1CCCC2=C1C=C(C=C2)[N+](=O)[O-] |
| Molecular Weight | 206.24 |
| Reaxy-Rn | 1684341 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1684341&ln= |
| Molecular Weight | 206.240 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 206.106 Da |
| Monoisotopic Mass | 206.106 Da |
| Topological Polar Surface Area | 49.100 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 239.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |