Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B182528-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$70.90
|
|
|
B182528-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$279.90
|
|
|
B182528-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$503.90
|
|
| Synonyms | 1-bromo-3-methyl-2-butanone | 1-bromo-3-methylbutan-2-one | 19967-55-6 | 1-bromo-3-methyl-butan-2-one | 2-Butanone, 1-bromo-3-methyl- | MFCD00015716 | Isopropyl bromomethyl ketone | 2-Bromo-1-isopropylethanone | 1-bromo-3methylbutan-2-one | SCHEMBL314018 | DTXSID90447581 | AKO |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones |
| Direct Parent | Alpha-haloketones |
| Alternative Parents | Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alpha-haloketone - Organic oxide - Hydrocarbon derivative - Organobromide - Organohalogen compound - Alkyl halide - Alkyl bromide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha-haloketones. These are organic compounds contaning a halogen atom attached to the alpha carbon atom relative to C=O group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-bromo-3-methylbutan-2-one |
|---|---|
| INCHI | InChI=1S/C5H9BrO/c1-4(2)5(7)3-6/h4H,3H2,1-2H3 |
| InChIKey | NNTPEAXKKUPBHQ-UHFFFAOYSA-N |
| Smiles | CC(C)C(=O)CBr |
| Isomeric SMILES | CC(C)C(=O)CBr |
| Molecular Weight | 165 |
| Reaxy-Rn | 741911 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=741911&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 19, 2024 | B182528 |
| Molecular Weight | 165.030 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 163.984 Da |
| Monoisotopic Mass | 163.984 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 68.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |