Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B179122-250mg
|
250mg |
3
|
$24.90
|
|
|
B179122-500mg
|
500mg |
3
|
$49.90
|
|
|
B179122-1g
|
1g |
3
|
$68.90
|
|
|
B179122-5g
|
5g |
3
|
$197.90
|
|
|
B179122-25g
|
25g |
2
|
$699.90
|
|
| Synonyms | SCHEMBL1061211 | AM807704 | EN300-7392826 | tert-Butyl 3,3-difluoro-4,4-dihydroxypiperidine-1-carboxylate | 1-BOC-3, 3-DIFLUORO-4,4-(DIHYDROXY)PIPERIDINE | B5931 | 1067914-83-3 | A895745 | DTXSID30725537 | 1-Boc-3,3-difluoro-4,4-(dihydroxy)piperidine | MF |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Carbamate esters Fluorohydrins Carbonyl hydrates Azacyclic compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Carbamic acid ester - Fluorohydrin - Halohydrin - Carbonyl hydrate - Azacycle - Organic oxide - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Alkyl halide - Hydrocarbon derivative - Alkyl fluoride - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504771597 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771597 |
| IUPAC Name | tert-butyl 3,3-difluoro-4,4-dihydroxypiperidine-1-carboxylate |
| INCHI | InChI=1S/C10H17F2NO4/c1-8(2,3)17-7(14)13-5-4-10(15,16)9(11,12)6-13/h15-16H,4-6H2,1-3H3 |
| InChIKey | WQBMVRTXKYXMKT-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)(O)O |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)(O)O |
| Molecular Weight | 253.2 |
| Reaxy-Rn | 18301666 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18301666&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 01, 2022 | B179122 | |
| Certificate of Analysis | Nov 01, 2022 | B179122 | |
| Certificate of Analysis | Nov 01, 2022 | B179122 | |
| Certificate of Analysis | Nov 01, 2022 | B179122 | |
| Certificate of Analysis | Nov 01, 2022 | B179122 |
| Solubility | Soluble in Methanol |
|---|---|
| Sensitivity | Air Sensitive,Moisture Sensitive |
| Molecular Weight | 253.240 g/mol |
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 253.113 Da |
| Monoisotopic Mass | 253.113 Da |
| Topological Polar Surface Area | 70.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 312.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |