Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A134989-1g
|
1g |
5
|
$44.90
|
|
|
A134989-5g
|
5g |
1
|
$171.90
|
|
|
A134989-25g
|
25g |
3
|
$773.90
|
|
| Synonyms | SY081456 | EN300-01848 | SCHEMBL354359 | FT-0605462 | 1-Adamantyl bromomethyl ketone | (+/-)-1,2,2,2-Tetrachloroethylchloroformate | adamantan-1-yl bromomethyl ketone | F1928-0001 | Bromomethyl adamantyl ketone | 1-((3r,5r,7r)-adamantan-1-yl)-2-bromoethan |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| Product Description |
1-Adamantyl bromomethyl ketone may be used in chemical synthesis studies. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones |
| Direct Parent | Alpha-haloketones |
| Alternative Parents | Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Alpha-haloketone - Organic oxide - Hydrocarbon derivative - Organobromide - Organohalogen compound - Alkyl halide - Alkyl bromide - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha-haloketones. These are organic compounds contaning a halogen atom attached to the alpha carbon atom relative to C=O group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488188582 |
|---|---|
| IUPAC Name | 1-(1-adamantyl)-2-bromoethanone |
| INCHI | InChI=1S/C12H17BrO/c13-7-11(14)12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2 |
| InChIKey | KWCDIRFSULAMOC-UHFFFAOYSA-N |
| Smiles | C1C2CC3CC1CC(C2)(C3)C(=O)CBr |
| Isomeric SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)CBr |
| WGK Germany | 3 |
| Molecular Weight | 257.17 |
| Reaxy-Rn | 1872228 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1872228&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 13, 2024 | A134989 | |
| Certificate of Analysis | Nov 13, 2024 | A134989 | |
| Certificate of Analysis | Apr 18, 2023 | A134989 | |
| Certificate of Analysis | Apr 18, 2023 | A134989 | |
| Certificate of Analysis | Oct 17, 2022 | A134989 | |
| Certificate of Analysis | Oct 17, 2022 | A134989 |
| Melt Point(°C) | 76-79 °C (lit.) |
|---|---|
| Molecular Weight | 257.170 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 256.046 Da |
| Monoisotopic Mass | 256.046 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 230.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |