Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N189916-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$9.90
|
|
|
N189916-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$23.90
|
|
| Synonyms | 1,6-naphthyridine-2-carboximidamide hydrochloride | 1179360-44-1 | 1,6-naphthyridine-2-carboximidamide;hydrochloride | 1,6-naphthyridine-2-carboximidamide HCl | 1,6-Naphthyridine-2-carboximidamidehydrochloride | DTXSID80676621 | MFCD12755571 | AKOS015848186 | DS-2951 | CS- |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Naphthyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthyridines |
| Alternative Parents | Pyridines and derivatives Heteroaromatic compounds Carboximidamides Carboxamidines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthyridine - Pyridine - Heteroaromatic compound - Azacycle - Carboximidamide - Carboxylic acid amidine - Amidine - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthyridines. These are compounds containing a naphthyridine moiety, a naphthalene in which a carbon atom has been replaced by a nitrogen in each of the two rings. The naphthyridine skeleton can also be described as an assembly two fused pyridine rings, which do not share their nitrogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,6-naphthyridine-2-carboximidamide;hydrochloride |
|---|---|
| INCHI | InChI=1S/C9H8N4.ClH/c10-9(11)8-2-1-6-5-12-4-3-7(6)13-8;/h1-5H,(H3,10,11);1H |
| InChIKey | BXXXFOITPZXWFP-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC2=C1C=NC=C2)C(=N)N.Cl |
| Isomeric SMILES | C1=CC(=NC2=C1C=NC=C2)C(=N)N.Cl |
| Molecular Weight | 208.65 |
| Reaxy-Rn | 38380613 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=38380613&ln= |
| Molecular Weight | 208.650 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 208.052 Da |
| Monoisotopic Mass | 208.052 Da |
| Topological Polar Surface Area | 75.700 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 204.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |