Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B405448-1g
|
1g |
4
|
$240.90
|
|
|
B405448-5g
|
5g |
1
|
$892.90
|
|
| Synonyms | B6150 | E82101 | AKOS024390505 | DTXSID20147724 | MFCD08276781 | Benzoic acid, 4,4'-[1,6-hexanediylbis(oxy)]bis- | AS-81220 | 1,6-Bis(p-carboxyphenoxy)hexane | 1,6-Bis(p-carboxyphenoxy)hexane, 90% | 4-[6-(4-carboxyphenoxy)hexoxy]benzoic acid | 1,6-bis(4-c |
|---|---|
| Specifications & Purity | ≥96% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoic acids |
| Alternative Parents | Phenoxy compounds Phenol ethers Benzoyl derivatives Alkyl aryl ethers Dicarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzoic acid - Phenoxy compound - Phenol ether - Benzoyl - Alkyl aryl ether - Dicarboxylic acid or derivatives - Ether - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoic acids. These are organic Compounds containing a benzene ring which bears at least one carboxyl group. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 488188571 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488188571 |
| IUPAC Name | 4-[6-(4-carboxyphenoxy)hexoxy]benzoic acid |
| INCHI | InChI=1S/C20H22O6/c21-19(22)15-5-9-17(10-6-15)25-13-3-1-2-4-14-26-18-11-7-16(8-12-18)20(23)24/h5-12H,1-4,13-14H2,(H,21,22)(H,23,24) |
| InChIKey | FQJXYULOQZUKBZ-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C(=O)O)OCCCCCCOC2=CC=C(C=C2)C(=O)O |
| Isomeric SMILES | C1=CC(=CC=C1C(=O)O)OCCCCCCOC2=CC=C(C=C2)C(=O)O |
| WGK Germany | 3 |
| UN Number | 3077 |
| Packing Group | III |
| Molecular Weight | 358.39 |
| Reaxy-Rn | 2670329 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2670329&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 12, 2022 | B405448 | |
| Certificate of Analysis | Sep 12, 2022 | B405448 | |
| Certificate of Analysis | Sep 12, 2022 | B405448 | |
| Certificate of Analysis | Sep 12, 2022 | B405448 | |
| Certificate of Analysis | Sep 12, 2022 | B405448 |
| Melt Point(°C) | 298 °C |
|---|---|
| Molecular Weight | 358.400 g/mol |
| XLogP3 | 4.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 11 |
| Exact Mass | 358.142 Da |
| Monoisotopic Mass | 358.142 Da |
| Topological Polar Surface Area | 93.100 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 382.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |