Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D683625-1g
|
1g |
1
|
$9.90
|
|
| Synonyms | DBN | 1,5-Diazabicyclo[4.3.0]non-5-ene | 2,3,4,6,7,8-Hexahydropyrrolo[1,2-a]pyrimidine | Pyrrolo[1,2-a]pyrimidine, 2,3,4,6,7,8-hexahydro- | 2H,3H,4H,6H,7H,8H-pyrrolo[1,2-a]pyrimidine |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyrimidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyrimidines |
| Alternative Parents | N-alkylpyrrolidines Imidolactams Hydropyrimidines Propargyl-type 1,3-dipolar organic compounds Carboximidamides Carboxamidines Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Pyrrolopyrimidine - Hydropyrimidine - 1,4,5,6-tetrahydropyrimidine - N-alkylpyrrolidine - Imidolactam - Pyrrolidine - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboxylic acid amidine - Carboximidamide - Amidine - Azacycle - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Organopnictogen compound - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyrimidines. These are compounds containing a pyrrolopyrimidine moiety, which consists of a pyrrole ring fused to a pyrimidine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine |
|---|---|
| INCHI | InChI=1S/C7H12N2/c1-3-7-8-4-2-6-9(7)5-1/h1-6H2 |
| InChIKey | SGUVLZREKBPKCE-UHFFFAOYSA-N |
| Smiles | C1CC2=NCCCN2C1 |
| Isomeric SMILES | C1CC2=NCCCN2C1 |
| WGK Germany | 3 |
| Molecular Weight | 124.18 |
| Beilstein | 2417 |
| Reaxy-Rn | 2417 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2417&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 12, 2024 | D683625 | |
| Certificate of Analysis | Aug 12, 2024 | D683625 | |
| Certificate of Analysis | Aug 12, 2024 | D683625 |
| Solubility | Soluble in ether, methanol, acetone and water |
|---|---|
| Sensitivity | air & Moisture & light sensitive |
| Refractive Index | 1.52 |
| Flash Point(°F) | 201.2 °F |
| Flash Point(°C) | 98°C |
| Boil Point(°C) | 108°C/15mmHg |
| Molecular Weight | 124.180 g/mol |
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 124.1 Da |
| Monoisotopic Mass | 124.1 Da |
| Topological Polar Surface Area | 15.600 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |