Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T168196-1g
|
1g |
3
|
$167.90
|
|
|
T168196-5g
|
5g |
1
|
$667.90
|
|
| Synonyms | 18960-29-7 | 4-(TRIFLUOROMETHYL)PHENYLBIGUANIDE HYDROCHLORIDE | 1-(4-Trifluoromethyl)phenylbiguanide hydrochloride | 1-[4-(Trifluoromethyl)phenyl]biguanide hydrochloride | 1-(diaminomethylidene)-2-[4-(trifluoromethyl)phenyl]guanidine;hydrochloride | 1-[(4-Trifluoro |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | Biguanides Propargyl-type 1,3-dipolar organic compounds Carboximidamides Organopnictogen compounds Organofluorides Imines Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Biguanide - Guanidine - Carboximidamide - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Alkyl fluoride - Hydrochloride - Hydrocarbon derivative - Organonitrogen compound - Organofluoride - Organohalogen compound - Imine - Organopnictogen compound - Organic nitrogen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504762040 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504762040 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(trifluoromethyl)phenyl]guanidine;hydrochloride |
| INCHI | InChI=1S/C9H10F3N5.ClH/c10-9(11,12)5-1-3-6(4-2-5)16-8(15)17-7(13)14;/h1-4H,(H6,13,14,15,16,17);1H |
| InChIKey | RTSKKAJVUWUZDF-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C(F)(F)F)N=C(N)N=C(N)N.Cl |
| Isomeric SMILES | C1=CC(=CC=C1C(F)(F)F)N=C(N)N=C(N)N.Cl |
| WGK Germany | 3 |
| PubChem CID | 2779358 |
| Molecular Weight | 281.67 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 07, 2024 | T168196 | |
| Certificate of Analysis | Apr 07, 2024 | T168196 | |
| Certificate of Analysis | Apr 07, 2024 | T168196 | |
| Certificate of Analysis | Apr 07, 2024 | T168196 |
| Sensitivity | Moisture sensitive. |
|---|---|
| Molecular Weight | 281.660 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 281.066 Da |
| Monoisotopic Mass | 281.066 Da |
| Topological Polar Surface Area | 103.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 311.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |