Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M632005-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$218.90
|
|
|
M632005-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$349.90
|
|
|
M632005-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$581.90
|
|
|
M632005-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,048.90
|
|
| Synonyms | 1-(4-methylpyridazin-3-yl)methanamine hydrochloride | 2173991-77-8 | 1-(4-methylpyridazin-3-yl)methanamine hcl | (4-methylpyridazin-3-yl)methanamine | hydrochloride | AMY35803 | MFCD31567447 | AKOS037644723 | SB40980 | AS-54279 | CS-0172776 | P17707 | (4- |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | (4-methylpyridazin-3-yl)methanamine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H9N3.ClH/c1-5-2-3-8-9-6(5)4-7;/h2-3H,4,7H2,1H3;1H |
| InChIKey | TZDKPEHURFMWPA-UHFFFAOYSA-N |
| Smiles | CC1=C(N=NC=C1)CN.Cl |
| PubChem CID | 132352654 |
| Molecular Weight | 159.620 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 159.056 Da |
| Monoisotopic Mass | 159.056 Da |
| Topological Polar Surface Area | 51.800 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 84.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |