Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C171648-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$163.90
|
|
| Synonyms | 3-ACETYL-4-CHLORO-7-AZAINDOLE | 1011711-52-6 | 1-(4-CHLORO-1H-PYRROLO[2,3-B]PYRIDIN-3-YL)ETHANONE | ETHANONE, 1-(4-CHLORO-1H-PYRROLO[2,3-B]PYRIDIN-3-YL)- | MFCD12828645 | 3-acetyl-4-chloro-7-azaindol | SCHEMBL1839435 | 1-{4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl}ethan-1- |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyridines |
| Alternative Parents | Aryl alkyl ketones Substituted pyrroles Pyridines and derivatives Aryl chlorides Vinylogous amides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyridine - Aryl alkyl ketone - Aryl ketone - Aryl chloride - Aryl halide - Pyridine - Substituted pyrrole - Heteroaromatic compound - Pyrrole - Vinylogous amide - Ketone - Azacycle - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyridines. These are compounds containing a pyrrolopyridine moiety, which consists of a pyrrole ring fused to a pyridine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| INCHI | InChI=1S/C9H7ClN2O/c1-5(13)6-4-12-9-8(6)7(10)2-3-11-9/h2-4H,1H3,(H,11,12) |
| InChIKey | UKCGIOZOYKFSGN-UHFFFAOYSA-N |
| Smiles | CC(=O)C1=CNC2=NC=CC(=C12)Cl |
| Isomeric SMILES | CC(=O)C1=CNC2=NC=CC(=C12)Cl |
| Molecular Weight | 194.62 |
| Reaxy-Rn | 15822451 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15822451&ln= |
| Molecular Weight | 194.620 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 194.025 Da |
| Monoisotopic Mass | 194.025 Da |
| Topological Polar Surface Area | 45.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |