Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B299733-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$687.90
|
|
Discover 1,4-bis(1H-pyrazol-4-yl)benzene by Aladdin Scientific in 98% for only $687.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1,4-di(1H-pyrazol-4-yl)benzene | 1036248-62-0 | 4-[4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole | H2bpzb | 4-(4-(1H-pyrazol-4-yl)phenyl)-1H-pyrazole | MFCD23704797 | 1,4-Di(4'-pyrazolyl)benzene | YSWG116 | 1,4-Di(4-pyrazolyl)benzene | SCHEMBL16432987 | 1,4-bis(1h-pyrazol-4-yl)benz |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrazoles |
| Alternative Parents | Benzene and substituted derivatives Heteroaromatic compounds Hydrazones Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpyrazole - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Hydrazone - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-[4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole |
|---|---|
| INCHI | InChI=1S/C12H10N4/c1-2-10(12-7-15-16-8-12)4-3-9(1)11-5-13-14-6-11/h1-8H,(H,13,14)(H,15,16) |
| InChIKey | RUGLQPNWHSDVER-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C2=CNN=C2)C3=CNN=C3 |
| Isomeric SMILES | C1=CC(=CC=C1C2=CNN=C2)C3=CNN=C3 |
| Molecular Weight | 210.24 |
| Reaxy-Rn | 11144319 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11144319&ln= |
| Molecular Weight | 210.230 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 210.091 Da |
| Monoisotopic Mass | 210.091 Da |
| Topological Polar Surface Area | 57.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |