Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T162078-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$35.90
|
|
|
T162078-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$274.90
|
|
| Synonyms | D92509 | 1,4,5-TRIMETHYLNAPHTHALENE | CS-0336455 | 1,4,5-Trimethyl naphthalene | MFCD00216209 | T1711 | CHEBI:89921 | E310186658 | Q27162105 | FT-0634053 | CAA13141 | DTXSID50175575 | 1,4,5-Trimethyl-naphtalene | FSAWRQYDMHSDRN-UHFFFAOYSA-N | EINECS 218-3 |
|---|---|
| Specifications & Purity | ≥96%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Aromatic hydrocarbons Polycyclic hydrocarbons Unsaturated hydrocarbons |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthalene - Aromatic hydrocarbon - Polycyclic hydrocarbon - Unsaturated hydrocarbon - Hydrocarbon - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 1,4,5-trimethylnaphthalene |
|---|---|
| INCHI | InChI=1S/C13H14/c1-9-7-8-11(3)13-10(2)5-4-6-12(9)13/h4-8H,1-3H3 |
| InChIKey | FSAWRQYDMHSDRN-UHFFFAOYSA-N |
| Smiles | CC1=C2C(=CC=C(C2=CC=C1)C)C |
| Isomeric SMILES | CC1=C2C(=CC=C(C2=CC=C1)C)C |
| PubChem CID | 16478 |
| Molecular Weight | 170.26 |
| Beilstein | 5(4)1728 |
| Reaxy-Rn | 2042200 |
| Boil Point(°C) | 145°C/12mmHg(lit.) |
|---|---|
| Melt Point(°C) | 60 °C |
| Molecular Weight | 170.250 g/mol |
| XLogP3 | 4.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 170.11 Da |
| Monoisotopic Mass | 170.11 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 173.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |