Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C178906-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,958.90
|
|
Discover 1-(3-Chloro-4-fluorophenyl)piperidine by Aladdin Scientific in 98% for only $1,958.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1-(3-Chloro-4-fluorophenyl)piperidine | 1033201-89-6 | DTXSID50674432 | MFCD10699654 | AKOS015848989 | SB43751 | BS-22622 | CS-0207877 | A896535 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Phenylpiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpiperidines |
| Alternative Parents | Dialkylarylamines Aniline and substituted anilines Fluorobenzenes Chlorobenzenes Aryl fluorides Aryl chlorides Azacyclic compounds Organofluorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpiperidine - Aniline or substituted anilines - Dialkylarylamine - Chlorobenzene - Fluorobenzene - Halobenzene - Aryl chloride - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Tertiary amine - Azacycle - Organohalogen compound - Hydrocarbon derivative - Organic nitrogen compound - Organochloride - Organofluoride - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpiperidines. These are compounds containing a phenylpiperidine skeleton, which consists of a piperidine bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)piperidine |
|---|---|
| INCHI | InChI=1S/C11H13ClFN/c12-10-8-9(4-5-11(10)13)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2 |
| InChIKey | FOWVTJMHLJVBHP-UHFFFAOYSA-N |
| Smiles | C1CCN(CC1)C2=CC(=C(C=C2)F)Cl |
| Isomeric SMILES | C1CCN(CC1)C2=CC(=C(C=C2)F)Cl |
| Molecular Weight | 213.7 |
| Reaxy-Rn | 42988939 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=42988939&ln= |
| Molecular Weight | 213.680 g/mol |
|---|---|
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 213.072 Da |
| Monoisotopic Mass | 213.072 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 182.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |