Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B111017-250mg
|
250mg |
3
|
$137.90
|
|
| Synonyms | 1,3-BUTYLENE GLYCOL [FCC] | ShiZhenTaiYiTang Moxibustion Patch | .beta.-Butylene glycol | 1,3-Butylene glycol | AI3-11077 | F8880-3340 | FT-0605126 | (R)-1,3-butanediol | 1,3-butane diol | 1,3-Butanodiol | AKOS000119043 | B0679 | BUTANEDIOL,1,3- | BUTYLEN |
|---|---|
| Specifications & Purity | analytical standard |
| Shipped In | Normal |
| Grade | analytical standard |
| Product Description |
A building block for proteomics research |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Secondary alcohols |
| Alternative Parents | Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Secondary alcohol - Hydrocarbon derivative - Primary alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as secondary alcohols. These are compounds containing a secondary alcohol functional group, with the general structure HOC(R)(R') (R,R'=alkyl, aryl). |
| External Descriptors | a glycol |
|
|
|
| IUPAC Name | butane-1,3-diol |
|---|---|
| INCHI | InChI=1S/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3 |
| InChIKey | PUPZLCDOIYMWBV-UHFFFAOYSA-N |
| Smiles | CC(CCO)O |
| Isomeric SMILES | CC(CCO)O |
| WGK Germany | 1 |
| RTECS | EK0440000 |
| Molecular Weight | 90.12 |
| Beilstein | 1731276 |
| Reaxy-Rn | 1718945 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1718945&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 20, 2025 | B111017 | |
| Certificate of Analysis | Jul 18, 2024 | B111017 | |
| Certificate of Analysis | Nov 11, 2022 | B111017 | |
| Certificate of Analysis | Jul 13, 2022 | B111017 |
| Solubility | Solubility in water: soluble Solubility in other solvents: soluble in acetone, methyl ethyl ketone, ethanol slightly soluble in ether practically insoluble in aliphatic hydrocarbons, benzene, toluene and CCl4. |
|---|---|
| Sensitivity | Hygroscopic |
| Refractive Index | 1.44 |
| Flash Point(°F) | 122℃ |
| Flash Point(°C) | 122℃ |
| Boil Point(°C) | 207°C |
| Melt Point(°C) | -50℃ |
| Molecular Weight | 90.120 g/mol |
| XLogP3 | -0.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 90.0681 Da |
| Monoisotopic Mass | 90.0681 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 28.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |