Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B299125-500g
|
500g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,099.90
|
|
| Synonyms | 6440-58-0 | 1,3-Bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione | DMDM Hydantoin | Dimethyloldimethyl hydantoin | Glydant | Dmdmh | 1,3-Bis(hydroxymethyl)-5,5-dimethylhydantoin | 1,3-Dimethylol-5,5-dimethylhydantoin | Dantoin-DMDMH | Glycoserve-DMDMH | Dantoin dmdmh 5 |
|---|---|
| Specifications & Purity | ≥55% |
| Storage Temp | Room temperature |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azolidines |
| Subclass | Imidazolidines |
| Intermediate Tree Nodes | Imidazolidinones - Imidazolidinediones |
| Direct Parent | Hydantoins |
| Alternative Parents | Alpha amino acids and derivatives N-acyl ureas Dicarboximides Azacyclic compounds Alkanolamines Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Hydantoin - Alpha-amino acid or derivatives - N-acyl urea - Ureide - Dicarboximide - Carbonic acid derivative - Urea - Alkanolamine - Carboxylic acid derivative - Azacycle - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Carbonyl group - Organonitrogen compound - Organooxygen compound - Organic nitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as hydantoins. These are heterocyclic compounds containing an imidazolidine substituted by ketone group at positions 2 and 4. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| INCHI | InChI=1S/C7H12N2O4/c1-7(2)5(12)8(3-10)6(13)9(7)4-11/h10-11H,3-4H2,1-2H3 |
| InChIKey | WSDISUOETYTPRL-UHFFFAOYSA-N |
| Smiles | CC1(C(=O)N(C(=O)N1CO)CO)C |
| Isomeric SMILES | CC1(C(=O)N(C(=O)N1CO)CO)C |
| Molecular Weight | 188.18 |
| Reaxy-Rn | 882348 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=882348&ln= |
| Melt Point(°C) | 94 - 97°C |
|---|---|
| Molecular Weight | 188.180 g/mol |
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 188.08 Da |
| Monoisotopic Mass | 188.08 Da |
| Topological Polar Surface Area | 81.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 251.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |