Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P404894-200mg
|
200mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$271.90
|
|
| Synonyms | 1,2,3,8-Tetrahydro-1,2,3,3,8-pentamethyl-5-(trifluoromethyl)-7H-pyrrolo[3,2-g]quinolin-7-one | DTXSID20886282 | CS-0086411 | 1,2,3,3,8-Pentamethyl-5-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[3,2-g]quinolin-7(8H)-one | EINECS 261-404-2 | 1,2,3,3,8-pentameth |
|---|---|
| Specifications & Purity | ≥98%(HPLC)(T) |
| Product Description |
Maximum Absorption Wavelength:388(EtOH)nm |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Pyrroloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrroloquinolines |
| Alternative Parents | Hydroquinolones Aminoquinolines and derivatives Hydroquinolines Indoles and derivatives Dialkylarylamines Pyridinones Aralkylamines Benzenoids Heteroaromatic compounds Lactams Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrroloquinoline - Dihydroquinolone - Aminoquinoline - Dihydroquinoline - Indole or derivatives - Dialkylarylamine - Tertiary aliphatic/aromatic amine - Aralkylamine - Pyridinone - Benzenoid - Pyridine - Heteroaromatic compound - Tertiary amine - Lactam - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Amine - Alkyl halide - Alkyl fluoride - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrroloquinolines. These are compounds containing a pyrroloquinoline moiety, which consists of a pyrrole ring fused to a quinoline. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,2,3,3,8-pentamethyl-5-(trifluoromethyl)-2H-pyrrolo[3,2-g]quinolin-7-one |
|---|---|
| INCHI | InChI=1S/C17H19F3N2O/c1-9-16(2,3)12-6-10-11(17(18,19)20)7-15(23)22(5)13(10)8-14(12)21(9)4/h6-9H,1-5H3 |
| InChIKey | IOUKYANHUBKAIN-UHFFFAOYSA-N |
| Smiles | CC1C(C2=C(N1C)C=C3C(=C2)C(=CC(=O)N3C)C(F)(F)F)(C)C |
| Isomeric SMILES | CC1C(C2=C(N1C)C=C3C(=C2)C(=CC(=O)N3C)C(F)(F)F)(C)C |
| PubChem CID | 93886 |
| Molecular Weight | 324.35 |
| Reaxy-Rn | 7942109 |
| Molecular Weight | 324.340 g/mol |
|---|---|
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 324.145 Da |
| Monoisotopic Mass | 324.145 Da |
| Topological Polar Surface Area | 23.600 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 555.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |